N-[1-(adamantan-1-yl)ethyl]-2-phenylimidazo[2,1-b][1,3]benzothiazole-7-carboxamide
Chemical Structure Depiction of
N-[1-(adamantan-1-yl)ethyl]-2-phenylimidazo[2,1-b][1,3]benzothiazole-7-carboxamide
N-[1-(adamantan-1-yl)ethyl]-2-phenylimidazo[2,1-b][1,3]benzothiazole-7-carboxamide
Compound characteristics
| Compound ID: | E235-1514 |
| Compound Name: | N-[1-(adamantan-1-yl)ethyl]-2-phenylimidazo[2,1-b][1,3]benzothiazole-7-carboxamide |
| Molecular Weight: | 455.62 |
| Molecular Formula: | C28 H29 N3 O S |
| Smiles: | CC(C12CC3CC(CC(C3)C2)C1)NC(c1ccc2c(c1)sc1nc(cn12)c1ccccc1)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.4899 |
| logD: | 6.4608 |
| logSw: | -5.6378 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 32.555 |
| InChI Key: | LXCBSPYEKKOJAN-BBXRDKHSSA-N |