N-(2-fluorophenyl)-2-{2-[3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide
Chemical Structure Depiction of
N-(2-fluorophenyl)-2-{2-[3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide
N-(2-fluorophenyl)-2-{2-[3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide
Compound characteristics
| Compound ID: | E239-0632 |
| Compound Name: | N-(2-fluorophenyl)-2-{2-[3-(4-methylphenyl)-5-phenyl-4,5-dihydro-1H-pyrazol-1-yl]-4-oxo-4,5-dihydro-1,3-thiazol-5-yl}acetamide |
| Molecular Weight: | 486.57 |
| Molecular Formula: | C27 H23 F N4 O2 S |
| Smiles: | Cc1ccc(cc1)C1CC(c2ccccc2)N(C2=NC(C(CC(Nc3ccccc3F)=O)S2)=O)N=1 |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 5.2175 |
| logD: | 5.2169 |
| logSw: | -5.0599 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 58.275 |
| InChI Key: | ITDVJMUEPCEZTQ-UHFFFAOYSA-N |