N-(2-ethoxyphenyl)-2-(4-oxo[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetamide
Chemical Structure Depiction of
N-(2-ethoxyphenyl)-2-(4-oxo[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetamide
N-(2-ethoxyphenyl)-2-(4-oxo[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetamide
Compound characteristics
| Compound ID: | E243-0048 |
| Compound Name: | N-(2-ethoxyphenyl)-2-(4-oxo[1]benzofuro[3,2-d]pyrimidin-3(4H)-yl)acetamide |
| Molecular Weight: | 363.37 |
| Molecular Formula: | C20 H17 N3 O4 |
| Smiles: | CCOc1ccccc1NC(CN1C=Nc2c3ccccc3oc2C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.0074 |
| logD: | 3.0074 |
| logSw: | -3.1779 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.896 |
| InChI Key: | GKUKOWUWUXKXFA-UHFFFAOYSA-N |