3-(3-nitrophenyl)-6-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Chemical Structure Depiction of
3-(3-nitrophenyl)-6-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
3-(3-nitrophenyl)-6-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid
Compound characteristics
| Compound ID: | E455-0422 |
| Compound Name: | 3-(3-nitrophenyl)-6-(3,4,5-trimethoxyphenyl)-2H-pyrazolo[3,4-b]pyridine-4-carboxylic acid |
| Molecular Weight: | 450.41 |
| Molecular Formula: | C22 H18 N4 O7 |
| Smiles: | COc1cc(cc(c1OC)OC)c1cc(C(O)=O)c2c(n1)n[nH]c2c1cccc(c1)[N+]([O-])=O |
| Stereo: | ACHIRAL |
| logP: | 4.2324 |
| logD: | -0.5567 |
| logSw: | -4.542 |
| Hydrogen bond acceptors count: | 12 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 117.652 |
| InChI Key: | NRHZUWWJRGOJJN-UHFFFAOYSA-N |