4-acetyl-N-(3-ethylphenyl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-(3-ethylphenyl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
4-acetyl-N-(3-ethylphenyl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | E459-0301 |
| Compound Name: | 4-acetyl-N-(3-ethylphenyl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide |
| Molecular Weight: | 376.49 |
| Molecular Formula: | C18 H20 N2 O3 S2 |
| Smiles: | CCc1cccc(c1)NS(c1ccc2c(c1)N(CCS2)C(C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 3.4225 |
| logD: | 3.4069 |
| logSw: | -3.8466 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.94 |
| InChI Key: | ASEQVDITOWYANW-UHFFFAOYSA-N |