4-acetyl-N-(2-methylbutan-2-yl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-(2-methylbutan-2-yl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
4-acetyl-N-(2-methylbutan-2-yl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | E459-0302 |
| Compound Name: | 4-acetyl-N-(2-methylbutan-2-yl)-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide |
| Molecular Weight: | 342.48 |
| Molecular Formula: | C15 H22 N2 O3 S2 |
| Smiles: | CCC(C)(C)NS(c1ccc2c(c1)N(CCS2)C(C)=O)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1793 |
| logD: | 2.1791 |
| logSw: | -2.8405 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.825 |
| InChI Key: | QTSRBEBZQSUCRU-UHFFFAOYSA-N |