3-hexyl-1-methyl-8-(3-methylphenyl)-7,8-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione
Chemical Structure Depiction of
3-hexyl-1-methyl-8-(3-methylphenyl)-7,8-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione
3-hexyl-1-methyl-8-(3-methylphenyl)-7,8-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione
Compound characteristics
| Compound ID: | E461-0539 |
| Compound Name: | 3-hexyl-1-methyl-8-(3-methylphenyl)-7,8-dihydro-1H-imidazo[2,1-f]purine-2,4(3H,6H)-dione |
| Molecular Weight: | 381.48 |
| Molecular Formula: | C21 H27 N5 O2 |
| Smiles: | CCCCCCN1C(c2c(nc3N(CCn23)c2cccc(C)c2)N(C)C1=O)=O |
| Stereo: | ACHIRAL |
| logP: | 5.0973 |
| logD: | 4.8147 |
| logSw: | -4.781 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 45.399 |
| InChI Key: | OUEBZLRPBZZDNC-UHFFFAOYSA-N |