N-[(furan-2-yl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
					Chemical Structure Depiction of
N-[(furan-2-yl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
			N-[(furan-2-yl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | E465-0196 | 
| Compound Name: | N-[(furan-2-yl)methyl]-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide | 
| Molecular Weight: | 324.37 | 
| Molecular Formula: | C13 H12 N2 O4 S2 | 
| Smiles: | C(c1ccco1)NS(c1ccc2c(c1)NC(CS2)=O)(=O)=O | 
| Stereo: | ACHIRAL | 
| logP: | 1.6331 | 
| logD: | 1.6327 | 
| logSw: | -2.4352 | 
| Hydrogen bond acceptors count: | 9 | 
| Hydrogen bond donors count: | 2 | 
| Polar surface area: | 74.566 | 
| InChI Key: | NESFJKRNSZYVTN-UHFFFAOYSA-N | 
 
				 
				