N-(4-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
N-(4-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | E465-0532 |
| Compound Name: | N-(4-methoxyphenyl)-2-methyl-3-oxo-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide |
| Molecular Weight: | 364.44 |
| Molecular Formula: | C16 H16 N2 O4 S2 |
| Smiles: | CC1C(Nc2cc(ccc2S1)S(Nc1ccc(cc1)OC)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.9861 |
| logD: | 2.9359 |
| logSw: | -3.6396 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 73.309 |
| InChI Key: | CQPGYEDZMKCTJA-SNVBAGLBSA-N |