3-(4-methylphenyl)-4-(4-phenylpiperazin-1-yl)cyclobut-3-ene-1,2-dione
Chemical Structure Depiction of
3-(4-methylphenyl)-4-(4-phenylpiperazin-1-yl)cyclobut-3-ene-1,2-dione
3-(4-methylphenyl)-4-(4-phenylpiperazin-1-yl)cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | E470-0083 |
| Compound Name: | 3-(4-methylphenyl)-4-(4-phenylpiperazin-1-yl)cyclobut-3-ene-1,2-dione |
| Molecular Weight: | 332.4 |
| Molecular Formula: | C21 H20 N2 O2 |
| Smiles: | Cc1ccc(cc1)C1=C(C(C1=O)=O)N1CCN(CC1)c1ccccc1 |
| Stereo: | ACHIRAL |
| logP: | 4.0278 |
| logD: | 4.0278 |
| logSw: | -4.0619 |
| Hydrogen bond acceptors count: | 4 |
| Polar surface area: | 33.414 |
| InChI Key: | HSTOKDPUHXFABW-UHFFFAOYSA-N |