3-{[2-(4-chlorophenyl)ethyl]amino}-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione
Chemical Structure Depiction of
3-{[2-(4-chlorophenyl)ethyl]amino}-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione
3-{[2-(4-chlorophenyl)ethyl]amino}-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | E470-0577 |
| Compound Name: | 3-{[2-(4-chlorophenyl)ethyl]amino}-4-(3,4-dimethylphenyl)cyclobut-3-ene-1,2-dione |
| Molecular Weight: | 339.82 |
| Molecular Formula: | C20 H18 Cl N O2 |
| Smiles: | Cc1ccc(cc1C)C1=C(C(C1=O)=O)NCCc1ccc(cc1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.4117 |
| logD: | 4.4117 |
| logSw: | -4.5096 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 37.058 |
| InChI Key: | HRLDRCOSKVADKO-UHFFFAOYSA-N |