3-(3,4-dimethylanilino)-4-(4-methoxyphenyl)cyclobut-3-ene-1,2-dione
Chemical Structure Depiction of
3-(3,4-dimethylanilino)-4-(4-methoxyphenyl)cyclobut-3-ene-1,2-dione
3-(3,4-dimethylanilino)-4-(4-methoxyphenyl)cyclobut-3-ene-1,2-dione
Compound characteristics
| Compound ID: | E470-0910 |
| Compound Name: | 3-(3,4-dimethylanilino)-4-(4-methoxyphenyl)cyclobut-3-ene-1,2-dione |
| Molecular Weight: | 307.35 |
| Molecular Formula: | C19 H17 N O3 |
| Smiles: | Cc1ccc(cc1C)NC1=C(C(C1=O)=O)c1ccc(cc1)OC |
| Stereo: | ACHIRAL |
| logP: | 4.1526 |
| logD: | 4.1524 |
| logSw: | -4.2941 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 43.438 |
| InChI Key: | BRJXKGIRDGXUPV-UHFFFAOYSA-N |