4-acetyl-N-(4-bromo-3-methylphenyl)-2-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Chemical Structure Depiction of
4-acetyl-N-(4-bromo-3-methylphenyl)-2-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
4-acetyl-N-(4-bromo-3-methylphenyl)-2-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide
Compound characteristics
| Compound ID: | E470-1072 |
| Compound Name: | 4-acetyl-N-(4-bromo-3-methylphenyl)-2-methyl-3,4-dihydro-2H-1,4-benzothiazine-6-sulfonamide |
| Molecular Weight: | 455.39 |
| Molecular Formula: | C18 H19 Br N2 O3 S2 |
| Smiles: | CC1CN(C(C)=O)c2cc(ccc2S1)S(Nc1ccc(c(C)c1)[Br])(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.3306 |
| logD: | 3.7996 |
| logSw: | -4.2622 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 56.874 |
| InChI Key: | ARQWVBUARVAVOC-GFCCVEGCSA-N |