N-(2,5-dimethoxyphenyl)-11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazoline-3-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazoline-3-carboxamide
N-(2,5-dimethoxyphenyl)-11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazoline-3-carboxamide
Compound characteristics
| Compound ID: | E475-0067 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-11-oxo-6,8,9,11-tetrahydro-7H-pyrido[2,1-b]quinazoline-3-carboxamide |
| Molecular Weight: | 379.41 |
| Molecular Formula: | C21 H21 N3 O4 |
| Smiles: | COc1ccc(c(c1)NC(c1ccc2C(N3CCCCC3=Nc2c1)=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.1676 |
| logD: | 2.1358 |
| logSw: | -3.1137 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 63.956 |
| InChI Key: | ZMPLJPVBFMEHAQ-UHFFFAOYSA-N |