3-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonyl)-N-(4-methoxyphenyl)propanamide
Chemical Structure Depiction of
3-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonyl)-N-(4-methoxyphenyl)propanamide
3-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonyl)-N-(4-methoxyphenyl)propanamide
Compound characteristics
| Compound ID: | E511-0528 |
| Compound Name: | 3-(6-chloro-3-oxo-3,4-dihydro-2H-1,4-benzoxazine-7-sulfonyl)-N-(4-methoxyphenyl)propanamide |
| Molecular Weight: | 424.86 |
| Molecular Formula: | C18 H17 Cl N2 O6 S |
| Smiles: | COc1ccc(cc1)NC(CCS(c1cc2c(cc1[Cl])NC(CO2)=O)(=O)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 1.811 |
| logD: | 1.7895 |
| logSw: | -2.7878 |
| Hydrogen bond acceptors count: | 10 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 92.966 |
| InChI Key: | BHORBOHOINCJOM-UHFFFAOYSA-N |