N-(2,5-dimethoxyphenyl)-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
N-(2,5-dimethoxyphenyl)-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | E511-3677 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 393.46 |
| Molecular Formula: | C18 H23 N3 O5 S |
| Smiles: | COc1ccc(c(c1)NC(c1cc(c[nH]1)S(N1CCCCC1)(=O)=O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 2.3492 |
| logD: | 2.3305 |
| logSw: | -3.0545 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 79.673 |
| InChI Key: | BHXSPIRUTQOZFI-UHFFFAOYSA-N |