methyl 4-[(3,4-dimethylphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
Chemical Structure Depiction of
methyl 4-[(3,4-dimethylphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
methyl 4-[(3,4-dimethylphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate
Compound characteristics
| Compound ID: | E511-3734 |
| Compound Name: | methyl 4-[(3,4-dimethylphenyl)sulfamoyl]-1H-pyrrole-2-carboxylate |
| Molecular Weight: | 308.35 |
| Molecular Formula: | C14 H16 N2 O4 S |
| Smiles: | Cc1ccc(cc1C)NS(c1cc(C(=O)OC)[nH]c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.9269 |
| logD: | 2.9258 |
| logSw: | -3.4275 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 72.218 |
| InChI Key: | NQXRURHIHWRBGE-UHFFFAOYSA-N |