N-[(4-fluorophenyl)methyl]-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
N-[(4-fluorophenyl)methyl]-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide
Compound characteristics
| Compound ID: | E511-4035 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-4-(piperidine-1-sulfonyl)-1H-pyrrole-2-carboxamide |
| Molecular Weight: | 365.42 |
| Molecular Formula: | C17 H20 F N3 O3 S |
| Smiles: | C1CCN(CC1)S(c1cc(C(NCc2ccc(cc2)F)=O)[nH]c1)(=O)=O |
| Stereo: | ACHIRAL |
| logP: | 2.1374 |
| logD: | 2.1373 |
| logSw: | -2.8407 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 66.519 |
| InChI Key: | RTADHOYGCIXZFA-UHFFFAOYSA-N |