5-ethyl-8-{[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]sulfanyl}thieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazine
Chemical Structure Depiction of
5-ethyl-8-{[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]sulfanyl}thieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazine
5-ethyl-8-{[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]sulfanyl}thieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazine
Compound characteristics
| Compound ID: | E513-0941 |
| Compound Name: | 5-ethyl-8-{[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]sulfanyl}thieno[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazine |
| Molecular Weight: | 406.53 |
| Molecular Formula: | C21 H18 N4 O S2 |
| Smiles: | CCc1nnc(c2cc3c(ccs3)n12)SCc1c(C)oc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.87 |
| logD: | 4.866 |
| logSw: | -4.7084 |
| Hydrogen bond acceptors count: | 5 |
| Polar surface area: | 40.436 |
| InChI Key: | PCZDVGMSXBWHIG-UHFFFAOYSA-N |