2-[(2,5-dimethylfuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
Chemical Structure Depiction of
2-[(2,5-dimethylfuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
2-[(2,5-dimethylfuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide
Compound characteristics
| Compound ID: | E514-0567 |
| Compound Name: | 2-[(2,5-dimethylfuro[2',3':4,5]pyrrolo[1,2-d][1,2,4]triazin-8-yl)sulfanyl]-N-(2-fluorophenyl)butanamide |
| Molecular Weight: | 398.46 |
| Molecular Formula: | C20 H19 F N4 O2 S |
| Smiles: | CCC(C(Nc1ccccc1F)=O)Sc1c2cc3c(cc(C)o3)n2c(C)nn1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.0882 |
| logD: | 4.0823 |
| logSw: | -4.1431 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 51.747 |
| InChI Key: | MEAIPEPXIHRVAK-SFHVURJKSA-N |