N-[(4-fluorophenyl)methyl]-1-[(4-fluorophenyl)(methyl)sulfamoyl]piperidine-3-carboxamide
Chemical Structure Depiction of
N-[(4-fluorophenyl)methyl]-1-[(4-fluorophenyl)(methyl)sulfamoyl]piperidine-3-carboxamide
N-[(4-fluorophenyl)methyl]-1-[(4-fluorophenyl)(methyl)sulfamoyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | E515-1506 |
| Compound Name: | N-[(4-fluorophenyl)methyl]-1-[(4-fluorophenyl)(methyl)sulfamoyl]piperidine-3-carboxamide |
| Molecular Weight: | 423.48 |
| Molecular Formula: | C20 H23 F2 N3 O3 S |
| Smiles: | CN(c1ccc(cc1)F)S(N1CCCC(C1)C(NCc1ccc(cc1)F)=O)(=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.3095 |
| logD: | 2.3095 |
| logSw: | -2.8132 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 59.812 |
| InChI Key: | YGZLMMGUQVEQRJ-INIZCTEOSA-N |