1-[ethyl(4-methoxyphenyl)sulfamoyl]-N-[3-(propylsulfanyl)propyl]piperidine-3-carboxamide
Chemical Structure Depiction of
1-[ethyl(4-methoxyphenyl)sulfamoyl]-N-[3-(propylsulfanyl)propyl]piperidine-3-carboxamide
1-[ethyl(4-methoxyphenyl)sulfamoyl]-N-[3-(propylsulfanyl)propyl]piperidine-3-carboxamide
Compound characteristics
| Compound ID: | E515-1823 |
| Compound Name: | 1-[ethyl(4-methoxyphenyl)sulfamoyl]-N-[3-(propylsulfanyl)propyl]piperidine-3-carboxamide |
| Molecular Weight: | 457.65 |
| Molecular Formula: | C21 H35 N3 O4 S2 |
| Smiles: | CCCSCCCNC(C1CCCN(C1)S(N(CC)c1ccc(cc1)OC)(=O)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 2.5439 |
| logD: | 2.5439 |
| logSw: | -2.8574 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 66.198 |
| InChI Key: | DXJXSJACOXWYJV-SFHVURJKSA-N |