1-[(3-fluorophenyl)methyl]-3-({[2-(furan-2-yl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-[(3-fluorophenyl)methyl]-3-({[2-(furan-2-yl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
1-[(3-fluorophenyl)methyl]-3-({[2-(furan-2-yl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E518-0495 |
| Compound Name: | 1-[(3-fluorophenyl)methyl]-3-({[2-(furan-2-yl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid |
| Molecular Weight: | 392.43 |
| Molecular Formula: | C23 H21 F N2 O3 |
| Smiles: | C(CNCc1c2ccccc2n(Cc2cccc(c2)F)c1C(O)=O)c1ccco1 |
| Stereo: | ACHIRAL |
| logP: | 3.7073 |
| logD: | 3.7073 |
| logSw: | -4.1939 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.233 |
| InChI Key: | ADRIBJAMQQBMBD-UHFFFAOYSA-N |