1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[(propylamino)methyl]-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[(propylamino)methyl]-1H-indole-2-carboxylic acid
1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[(propylamino)methyl]-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E518-0656 |
| Compound Name: | 1-[(2-chloro-4-fluorophenyl)methyl]-6-methoxy-3-[(propylamino)methyl]-1H-indole-2-carboxylic acid |
| Molecular Weight: | 404.87 |
| Molecular Formula: | C21 H22 Cl F N2 O3 |
| Smiles: | CCCNCc1c2ccc(cc2n(Cc2ccc(cc2[Cl])F)c1C(O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 4.6045 |
| logD: | 4.6045 |
| logSw: | -4.4917 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.299 |
| InChI Key: | HWYUHKPIEHRSJF-UHFFFAOYSA-N |