3-({[(4-chlorophenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
3-({[(4-chlorophenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
3-({[(4-chlorophenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E518-0943 |
| Compound Name: | 3-({[(4-chlorophenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid |
| Molecular Weight: | 452.91 |
| Molecular Formula: | C25 H22 Cl F N2 O3 |
| Smiles: | COc1ccc2c(CNCc3ccc(cc3)[Cl])c(C(O)=O)n(Cc3ccc(cc3)F)c2c1 |
| Stereo: | ACHIRAL |
| logP: | 4.9113 |
| logD: | 4.9113 |
| logSw: | -4.7178 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.186 |
| InChI Key: | VRMSXTIDJDURNX-UHFFFAOYSA-N |