3-({[(4-ethoxy-3-methoxyphenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
3-({[(4-ethoxy-3-methoxyphenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
3-({[(4-ethoxy-3-methoxyphenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E518-0989 |
| Compound Name: | 3-({[(4-ethoxy-3-methoxyphenyl)methyl]amino}methyl)-1-[(4-fluorophenyl)methyl]-6-methoxy-1H-indole-2-carboxylic acid |
| Molecular Weight: | 492.55 |
| Molecular Formula: | C28 H29 F N2 O5 |
| Smiles: | CCOc1ccc(CNCc2c3ccc(cc3n(Cc3ccc(cc3)F)c2C(O)=O)OC)cc1OC |
| Stereo: | ACHIRAL |
| logP: | 4.2771 |
| logD: | 4.2771 |
| logSw: | -4.3859 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 63.027 |
| InChI Key: | AZXBNBMXVKWGQD-UHFFFAOYSA-N |