1-benzyl-6-methoxy-3-({[2-(2-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Chemical Structure Depiction of
1-benzyl-6-methoxy-3-({[2-(2-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
1-benzyl-6-methoxy-3-({[2-(2-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid
Compound characteristics
| Compound ID: | E518-1066 |
| Compound Name: | 1-benzyl-6-methoxy-3-({[2-(2-methylphenyl)ethyl]amino}methyl)-1H-indole-2-carboxylic acid |
| Molecular Weight: | 428.53 |
| Molecular Formula: | C27 H28 N2 O3 |
| Smiles: | Cc1ccccc1CCNCc1c2ccc(cc2n(Cc2ccccc2)c1C(O)=O)OC |
| Stereo: | ACHIRAL |
| logP: | 5.0682 |
| logD: | 5.0682 |
| logSw: | -4.7569 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 48.028 |
| InChI Key: | TVHDPTGIXODQQD-UHFFFAOYSA-N |