4-{2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-oxoethyl}-2-phenyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one
Chemical Structure Depiction of
4-{2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-oxoethyl}-2-phenyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one
4-{2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-oxoethyl}-2-phenyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one
Compound characteristics
| Compound ID: | E521-0021 |
| Compound Name: | 4-{2-[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-2-oxoethyl}-2-phenyl-2H-pyrido[3,2-b][1,4]oxazin-3(4H)-one |
| Molecular Weight: | 476.96 |
| Molecular Formula: | C26 H25 Cl N4 O3 |
| Smiles: | Cc1ccc(cc1N1CCN(CC1)C(CN1C(C(c2ccccc2)Oc2cccnc12)=O)=O)[Cl] |
| Stereo: | RACEMIC MIXTURE |
| logP: | 4.1145 |
| logD: | 4.1145 |
| logSw: | -4.5024 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 52.435 |
| InChI Key: | JBKTVIHXRGSVQL-XMMPIXPASA-N |