N-(3-ethoxypropyl)-4-(3-oxo-2-phenyl-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazin-4-yl)butanamide
Chemical Structure Depiction of
N-(3-ethoxypropyl)-4-(3-oxo-2-phenyl-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazin-4-yl)butanamide
N-(3-ethoxypropyl)-4-(3-oxo-2-phenyl-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazin-4-yl)butanamide
Compound characteristics
| Compound ID: | E521-1291 |
| Compound Name: | N-(3-ethoxypropyl)-4-(3-oxo-2-phenyl-2,3-dihydro-4H-pyrido[3,2-b][1,4]oxazin-4-yl)butanamide |
| Molecular Weight: | 397.47 |
| Molecular Formula: | C22 H27 N3 O4 |
| Smiles: | CCOCCCNC(CCCN1C(C(c2ccccc2)Oc2cccnc12)=O)=O |
| Stereo: | RACEMIC MIXTURE |
| logP: | 1.5889 |
| logD: | 1.5889 |
| logSw: | -1.9019 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 65.624 |
| InChI Key: | KVXOALPJQDJATJ-FQEVSTJZSA-N |