N-cyclooctyl-2-[(4-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole-3-carboxamide
Chemical Structure Depiction of
N-cyclooctyl-2-[(4-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole-3-carboxamide
N-cyclooctyl-2-[(4-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole-3-carboxamide
Compound characteristics
| Compound ID: | E525-0984 |
| Compound Name: | N-cyclooctyl-2-[(4-ethoxyphenyl)methyl]-3-methyl-1-oxo-1,2,3,4-tetrahydropyrazino[1,2-a]benzimidazole-3-carboxamide |
| Molecular Weight: | 488.63 |
| Molecular Formula: | C29 H36 N4 O3 |
| Smiles: | CCOc1ccc(CN2C(c3nc4ccccc4n3CC2(C)C(NC2CCCCCCC2)=O)=O)cc1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 6.1126 |
| logD: | 6.1126 |
| logSw: | -5.3419 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 57.757 |
| InChI Key: | DINXRQVYVVHGAL-LJAQVGFWSA-N |