N-{4-[({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)carbamoyl]phenyl}-2-methyl-5,6-dihydro-1,4-oxathiine-3-carboxamide
Chemical Structure Depiction of
N-{4-[({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)carbamoyl]phenyl}-2-methyl-5,6-dihydro-1,4-oxathiine-3-carboxamide
N-{4-[({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)carbamoyl]phenyl}-2-methyl-5,6-dihydro-1,4-oxathiine-3-carboxamide
Compound characteristics
| Compound ID: | E532-2318 |
| Compound Name: | N-{4-[({1-[(2-fluorophenyl)methyl]piperidin-4-yl}methyl)carbamoyl]phenyl}-2-methyl-5,6-dihydro-1,4-oxathiine-3-carboxamide |
| Molecular Weight: | 483.6 |
| Molecular Formula: | C26 H30 F N3 O3 S |
| Smiles: | CC1=C(C(Nc2ccc(cc2)C(NCC2CCN(CC2)Cc2ccccc2F)=O)=O)SCCO1 |
| Stereo: | ACHIRAL |
| logP: | 3.1417 |
| logD: | 3.1417 |
| logSw: | -3.3768 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 59.746 |
| InChI Key: | PCWTXWTXMHOFIK-UHFFFAOYSA-N |