{5-[(2-chlorobenzene-1-sulfinyl)methyl]furan-2-yl}[4-(3-chlorophenyl)piperazin-1-yl]methanone
Chemical Structure Depiction of
{5-[(2-chlorobenzene-1-sulfinyl)methyl]furan-2-yl}[4-(3-chlorophenyl)piperazin-1-yl]methanone
{5-[(2-chlorobenzene-1-sulfinyl)methyl]furan-2-yl}[4-(3-chlorophenyl)piperazin-1-yl]methanone
Compound characteristics
| Compound ID: | E535-2025 |
| Compound Name: | {5-[(2-chlorobenzene-1-sulfinyl)methyl]furan-2-yl}[4-(3-chlorophenyl)piperazin-1-yl]methanone |
| Molecular Weight: | 463.38 |
| Molecular Formula: | C22 H20 Cl2 N2 O3 S |
| Smiles: | C1CN(CCN1C(c1ccc(CS(c2ccccc2[Cl])=O)o1)=O)c1cccc(c1)[Cl] |
| Stereo: | ACHIRAL |
| logP: | 4.2958 |
| logD: | 4.2958 |
| logSw: | -4.3582 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 43.129 |
| InChI Key: | ZNYVANHHWZPJMG-UHFFFAOYSA-N |