5-[(2-chlorobenzene-1-sulfinyl)methyl]-N-[(4-methoxyphenyl)methyl]furan-2-carboxamide
Chemical Structure Depiction of
5-[(2-chlorobenzene-1-sulfinyl)methyl]-N-[(4-methoxyphenyl)methyl]furan-2-carboxamide
5-[(2-chlorobenzene-1-sulfinyl)methyl]-N-[(4-methoxyphenyl)methyl]furan-2-carboxamide
Compound characteristics
| Compound ID: | E535-2120 |
| Compound Name: | 5-[(2-chlorobenzene-1-sulfinyl)methyl]-N-[(4-methoxyphenyl)methyl]furan-2-carboxamide |
| Molecular Weight: | 403.88 |
| Molecular Formula: | C20 H18 Cl N O4 S |
| Smiles: | COc1ccc(CNC(c2ccc(CS(c3ccccc3[Cl])=O)o2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3944 |
| logD: | 3.3944 |
| logSw: | -3.6311 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 55.177 |
| InChI Key: | LUVPZBFBKNAXKX-UHFFFAOYSA-N |