4-(2-methyl-2,3-dihydro-4H-1,4-benzothiazin-4-yl)-N-(4-methylphenyl)-4-oxobutanamide
Chemical Structure Depiction of
4-(2-methyl-2,3-dihydro-4H-1,4-benzothiazin-4-yl)-N-(4-methylphenyl)-4-oxobutanamide
4-(2-methyl-2,3-dihydro-4H-1,4-benzothiazin-4-yl)-N-(4-methylphenyl)-4-oxobutanamide
Compound characteristics
| Compound ID: | E539-0491 |
| Compound Name: | 4-(2-methyl-2,3-dihydro-4H-1,4-benzothiazin-4-yl)-N-(4-methylphenyl)-4-oxobutanamide |
| Molecular Weight: | 354.47 |
| Molecular Formula: | C20 H22 N2 O2 S |
| Smiles: | CC1CN(C(CCC(Nc2ccc(C)cc2)=O)=O)c2ccccc2S1 |
| Stereo: | RACEMIC MIXTURE |
| logP: | 3.798 |
| logD: | 3.798 |
| logSw: | -3.92 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 38.107 |
| InChI Key: | CZIHBZLUCLNRRX-HNNXBMFYSA-N |