N-[(2-bromophenyl)methyl]-3-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}propanamide
Chemical Structure Depiction of
N-[(2-bromophenyl)methyl]-3-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}propanamide
N-[(2-bromophenyl)methyl]-3-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}propanamide
Compound characteristics
| Compound ID: | E542-1165 |
| Compound Name: | N-[(2-bromophenyl)methyl]-3-{1-[(4-chlorophenyl)methyl]-1H-indol-3-yl}propanamide |
| Molecular Weight: | 481.82 |
| Molecular Formula: | C25 H22 Br Cl N2 O |
| Smiles: | C(Cc1cn(Cc2ccc(cc2)[Cl])c2ccccc12)C(NCc1ccccc1[Br])=O |
| Stereo: | ACHIRAL |
| logP: | 6.1941 |
| logD: | 6.1941 |
| logSw: | -6.3302 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.1705 |
| InChI Key: | JREDESGUYKQCQX-UHFFFAOYSA-N |