ethyl 4-(3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}propanamido)piperidine-1-carboxylate
Chemical Structure Depiction of
ethyl 4-(3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}propanamido)piperidine-1-carboxylate
ethyl 4-(3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}propanamido)piperidine-1-carboxylate
Compound characteristics
| Compound ID: | E542-1224 |
| Compound Name: | ethyl 4-(3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}propanamido)piperidine-1-carboxylate |
| Molecular Weight: | 468 |
| Molecular Formula: | C26 H30 Cl N3 O3 |
| Smiles: | CCOC(N1CCC(CC1)NC(CCc1cn(Cc2ccccc2[Cl])c2ccccc12)=O)=O |
| Stereo: | ACHIRAL |
| logP: | 4.7735 |
| logD: | 4.7735 |
| logSw: | -4.6571 |
| Hydrogen bond acceptors count: | 5 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 48.676 |
| InChI Key: | ATYHZRRNVNEGQQ-UHFFFAOYSA-N |