3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-N-[3-(piperidin-1-yl)propyl]propanamide
Chemical Structure Depiction of
3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-N-[3-(piperidin-1-yl)propyl]propanamide
3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-N-[3-(piperidin-1-yl)propyl]propanamide
Compound characteristics
| Compound ID: | E542-1377 |
| Compound Name: | 3-{1-[(2-chlorophenyl)methyl]-1H-indol-3-yl}-N-[3-(piperidin-1-yl)propyl]propanamide |
| Molecular Weight: | 438.01 |
| Molecular Formula: | C26 H32 Cl N3 O |
| Smiles: | C1CCN(CC1)CCCNC(CCc1cn(Cc2ccccc2[Cl])c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 4.5194 |
| logD: | 1.8652 |
| logSw: | -4.3425 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 29.9945 |
| InChI Key: | KCFCGQBMTWCCSV-UHFFFAOYSA-N |