1-[4-(3-chlorophenyl)piperazin-1-yl]-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propan-1-one
Chemical Structure Depiction of
1-[4-(3-chlorophenyl)piperazin-1-yl]-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propan-1-one
1-[4-(3-chlorophenyl)piperazin-1-yl]-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propan-1-one
Compound characteristics
| Compound ID: | E542-1458 |
| Compound Name: | 1-[4-(3-chlorophenyl)piperazin-1-yl]-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propan-1-one |
| Molecular Weight: | 472.03 |
| Molecular Formula: | C29 H30 Cl N3 O |
| Smiles: | Cc1ccc(Cn2cc(CCC(N3CCN(CC3)c3cccc(c3)[Cl])=O)c3ccccc23)cc1 |
| Stereo: | ACHIRAL |
| logP: | 5.9624 |
| logD: | 5.9624 |
| logSw: | -6.0514 |
| Hydrogen bond acceptors count: | 2 |
| Polar surface area: | 21.3518 |
| InChI Key: | QULBITYUTDSQJZ-UHFFFAOYSA-N |