N-methyl-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propanamide
Chemical Structure Depiction of
N-methyl-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propanamide
N-methyl-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propanamide
Compound characteristics
| Compound ID: | E542-1643 |
| Compound Name: | N-methyl-3-{1-[(4-methylphenyl)methyl]-1H-indol-3-yl}propanamide |
| Molecular Weight: | 306.41 |
| Molecular Formula: | C20 H22 N2 O |
| Smiles: | Cc1ccc(Cn2cc(CCC(NC)=O)c3ccccc23)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.3806 |
| logD: | 3.3806 |
| logSw: | -3.2478 |
| Hydrogen bond acceptors count: | 2 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 26.5925 |
| InChI Key: | CPQWCDNKKUHELE-UHFFFAOYSA-N |