N-[2-(dipropylamino)ethyl]-3-{1-[(2-methylphenyl)methyl]-1H-indol-3-yl}propanamide
Chemical Structure Depiction of
N-[2-(dipropylamino)ethyl]-3-{1-[(2-methylphenyl)methyl]-1H-indol-3-yl}propanamide
N-[2-(dipropylamino)ethyl]-3-{1-[(2-methylphenyl)methyl]-1H-indol-3-yl}propanamide
Compound characteristics
| Compound ID: | E542-2785 |
| Compound Name: | N-[2-(dipropylamino)ethyl]-3-{1-[(2-methylphenyl)methyl]-1H-indol-3-yl}propanamide |
| Molecular Weight: | 419.61 |
| Molecular Formula: | C27 H37 N3 O |
| Smiles: | CCCN(CCC)CCNC(CCc1cn(Cc2ccccc2C)c2ccccc12)=O |
| Stereo: | ACHIRAL |
| logP: | 5.3382 |
| logD: | 3.4545 |
| logSw: | -5.2946 |
| Hydrogen bond acceptors count: | 3 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 30.202 |
| InChI Key: | LTZKLZUEAURRFL-UHFFFAOYSA-N |