[2-(4-ethylphenyl)-4-{[(2-fluorophenyl)methyl]sulfanyl}-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
Chemical Structure Depiction of
[2-(4-ethylphenyl)-4-{[(2-fluorophenyl)methyl]sulfanyl}-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
[2-(4-ethylphenyl)-4-{[(2-fluorophenyl)methyl]sulfanyl}-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
Compound characteristics
| Compound ID: | E544-0713 |
| Compound Name: | [2-(4-ethylphenyl)-4-{[(2-fluorophenyl)methyl]sulfanyl}-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol |
| Molecular Weight: | 473.57 |
| Molecular Formula: | C27 H24 F N3 O2 S |
| Smiles: | CCc1ccc(cc1)c1nc2c(Cc3c(CO)cnc(C)c3O2)c(n1)SCc1ccccc1F |
| Stereo: | ACHIRAL |
| logP: | 6.7471 |
| logD: | 6.7442 |
| logSw: | -5.7983 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 52.644 |
| InChI Key: | NPMDOYMIGHAODL-UHFFFAOYSA-N |