[4-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-2-(3-methoxyphenyl)-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
Chemical Structure Depiction of
[4-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-2-(3-methoxyphenyl)-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
[4-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-2-(3-methoxyphenyl)-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol
Compound characteristics
| Compound ID: | E544-0916 |
| Compound Name: | [4-{[(2-chloro-4-fluorophenyl)methyl]sulfanyl}-2-(3-methoxyphenyl)-9-methyl-5H-pyrido[4',3':5,6]pyrano[2,3-d]pyrimidin-6-yl]methanol |
| Molecular Weight: | 509.99 |
| Molecular Formula: | C26 H21 Cl F N3 O3 S |
| Smiles: | Cc1c2c(Cc3c(nc(c4cccc(c4)OC)nc3SCc3ccc(cc3[Cl])F)O2)c(CO)cn1 |
| Stereo: | ACHIRAL |
| logP: | 6.4899 |
| logD: | 6.4868 |
| logSw: | -6.2688 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 60.188 |
| InChI Key: | FQWUBSFMKATSEV-UHFFFAOYSA-N |