N-(4-nitrophenyl)-2-{[6-(thiophen-2-yl)pyridazin-3-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(4-nitrophenyl)-2-{[6-(thiophen-2-yl)pyridazin-3-yl]sulfanyl}acetamide
N-(4-nitrophenyl)-2-{[6-(thiophen-2-yl)pyridazin-3-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | E547-0147 |
| Compound Name: | N-(4-nitrophenyl)-2-{[6-(thiophen-2-yl)pyridazin-3-yl]sulfanyl}acetamide |
| Molecular Weight: | 372.42 |
| Molecular Formula: | C16 H12 N4 O3 S2 |
| Smiles: | C(C(Nc1ccc(cc1)[N+]([O-])=O)=O)Sc1ccc(c2cccs2)nn1 |
| Stereo: | ACHIRAL |
| logP: | 3.3581 |
| logD: | 3.3563 |
| logSw: | -3.6514 |
| Hydrogen bond acceptors count: | 9 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 78.349 |
| InChI Key: | JMFXFVDTOSWLOA-UHFFFAOYSA-N |