2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
Chemical Structure Depiction of
2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide
Compound characteristics
| Compound ID: | E549-0046 |
| Compound Name: | 2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}-N-[3-(trifluoromethyl)phenyl]acetamide |
| Molecular Weight: | 486.54 |
| Molecular Formula: | C23 H17 F3 N4 O S2 |
| Smiles: | Cc1c(c2ccc(nn2)SCC(Nc2cccc(c2)C(F)(F)F)=O)sc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 5.877 |
| logD: | 5.8765 |
| logSw: | -5.6099 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 54.259 |
| InChI Key: | HMNVHZXVYLDDKB-UHFFFAOYSA-N |