N-(4-methoxyphenyl)-2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}acetamide
Chemical Structure Depiction of
N-(4-methoxyphenyl)-2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}acetamide
N-(4-methoxyphenyl)-2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}acetamide
Compound characteristics
| Compound ID: | E549-0054 |
| Compound Name: | N-(4-methoxyphenyl)-2-{[6-(4-methyl-2-phenyl-1,3-thiazol-5-yl)pyridazin-3-yl]sulfanyl}acetamide |
| Molecular Weight: | 448.56 |
| Molecular Formula: | C23 H20 N4 O2 S2 |
| Smiles: | Cc1c(c2ccc(nn2)SCC(Nc2ccc(cc2)OC)=O)sc(c2ccccc2)n1 |
| Stereo: | ACHIRAL |
| logP: | 4.8161 |
| logD: | 4.8161 |
| logSw: | -4.6168 |
| Hydrogen bond acceptors count: | 7 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 61.803 |
| InChI Key: | SWVWBWHQXKUJAC-UHFFFAOYSA-N |