1-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethan-1-one
Chemical Structure Depiction of
1-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethan-1-one
1-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethan-1-one
Compound characteristics
| Compound ID: | E554-0160 |
| Compound Name: | 1-[4-(2,5-dimethylphenyl)piperazin-1-yl]-2-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]ethan-1-one |
| Molecular Weight: | 406.48 |
| Molecular Formula: | C23 H26 N4 O3 |
| Smiles: | Cc1ccc(C)c(c1)N1CCN(CC1)C(Cc1nc(c2ccc(cc2)OC)no1)=O |
| Stereo: | ACHIRAL |
| logP: | 4.6162 |
| logD: | 4.6161 |
| logSw: | -4.4588 |
| Hydrogen bond acceptors count: | 6 |
| Polar surface area: | 58.206 |
| InChI Key: | JQRMMKNMMJPPLW-UHFFFAOYSA-N |