3-(4-bromobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]thieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-5-amine
Chemical Structure Depiction of
3-(4-bromobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]thieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-5-amine
3-(4-bromobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]thieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-5-amine
Compound characteristics
| Compound ID: | E565-0805 |
| Compound Name: | 3-(4-bromobenzene-1-sulfonyl)-N-[(3-methoxyphenyl)methyl]thieno[2,3-e][1,2,3]triazolo[1,5-a]pyrimidin-5-amine |
| Molecular Weight: | 530.42 |
| Molecular Formula: | C21 H16 Br N5 O3 S2 |
| Smiles: | COc1cccc(CNc2c3c(ccs3)n3c(c(nn3)S(c3ccc(cc3)[Br])(=O)=O)n2)c1 |
| Stereo: | ACHIRAL |
| logP: | 4.9166 |
| logD: | 4.9166 |
| logSw: | -4.7696 |
| Hydrogen bond acceptors count: | 8 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 81.179 |
| InChI Key: | CQJKQXZEYOKDIH-UHFFFAOYSA-N |