N-[(1,2-benzoxazol-3-yl)methyl]-3,5-dimethylpiperidine-1-carboxamide
Chemical Structure Depiction of
N-[(1,2-benzoxazol-3-yl)methyl]-3,5-dimethylpiperidine-1-carboxamide
N-[(1,2-benzoxazol-3-yl)methyl]-3,5-dimethylpiperidine-1-carboxamide
Compound characteristics
| Compound ID: | E567-0076 |
| Compound Name: | N-[(1,2-benzoxazol-3-yl)methyl]-3,5-dimethylpiperidine-1-carboxamide |
| Molecular Weight: | 287.36 |
| Molecular Formula: | C16 H21 N3 O2 |
| Smiles: | CC1CC(C)CN(C1)C(NCc1c2ccccc2on1)=O |
| Stereo: | MIXTURE OF STEREOISOMERS |
| logP: | 3.3361 |
| logD: | 3.3361 |
| logSw: | -3.5293 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 1 |
| Polar surface area: | 49.591 |
| InChI Key: | LAOAZWFWCHELSL-UHFFFAOYSA-N |