N-(2,5-dimethoxyphenyl)-N'-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea
Chemical Structure Depiction of
N-(2,5-dimethoxyphenyl)-N'-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea
N-(2,5-dimethoxyphenyl)-N'-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea
Compound characteristics
| Compound ID: | E569-0066 |
| Compound Name: | N-(2,5-dimethoxyphenyl)-N'-[(5-methyl-1,2-benzoxazol-3-yl)methyl]urea |
| Molecular Weight: | 341.36 |
| Molecular Formula: | C18 H19 N3 O4 |
| Smiles: | Cc1ccc2c(c1)c(CNC(Nc1cc(ccc1OC)OC)=O)no2 |
| Stereo: | ACHIRAL |
| logP: | 3.253 |
| logD: | 3.253 |
| logSw: | -3.417 |
| Hydrogen bond acceptors count: | 6 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 71.034 |
| InChI Key: | MEUJLECTEJCMOH-UHFFFAOYSA-N |