N-[(5-methyl-1,2-benzoxazol-3-yl)methyl]-N'-[(4-methylphenyl)methyl]urea
Chemical Structure Depiction of
N-[(5-methyl-1,2-benzoxazol-3-yl)methyl]-N'-[(4-methylphenyl)methyl]urea
N-[(5-methyl-1,2-benzoxazol-3-yl)methyl]-N'-[(4-methylphenyl)methyl]urea
Compound characteristics
| Compound ID: | E569-0183 |
| Compound Name: | N-[(5-methyl-1,2-benzoxazol-3-yl)methyl]-N'-[(4-methylphenyl)methyl]urea |
| Molecular Weight: | 309.37 |
| Molecular Formula: | C18 H19 N3 O2 |
| Smiles: | Cc1ccc(CNC(NCc2c3cc(C)ccc3on2)=O)cc1 |
| Stereo: | ACHIRAL |
| logP: | 3.2407 |
| logD: | 3.2407 |
| logSw: | -3.2321 |
| Hydrogen bond acceptors count: | 4 |
| Hydrogen bond donors count: | 2 |
| Polar surface area: | 57.88 |
| InChI Key: | CGCJZDWNTBROOM-UHFFFAOYSA-N |